Difference between revisions of "Tiso gene 7235"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=XFTRTWQBIOMV...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13181 RXN-13181] == * direction: ** LEFT-TO-RIGHT * common name: ** sialate_o-acetylesterase-li...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13181 RXN-13181] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sialate_o-acetylesterase-like_protein |
− | * | + | ** ORF |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.1.1.53 EC-3.1.1.53] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-414]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[N-ACETYLNEURAMINATE]][c] |
− | == | + | * With common name(s): |
+ | ** 1 H2O[c] '''+''' 1 N-acetyl-4-O-acetylneuraminate[c] '''=>''' 1 H+[c] '''+''' 1 acetate[c] '''+''' 1 N-acetylneuraminate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_17029]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_4419]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_4418]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=25567 25567] | |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=sialate_o-acetylesterase-like_protein}} | |
− | + | {{#set: common name=ORF}} | |
− | + | {{#set: ec number=EC-3.1.1.53}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: gene associated=Tiso_gene_17029|Tiso_gene_4419|Tiso_gene_4418}} |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:49, 21 March 2018
Contents
Reaction RXN-13181
- direction:
- LEFT-TO-RIGHT
- common name:
- sialate_o-acetylesterase-like_protein
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 CPD-414[c] => 1 PROTON[c] + 1 ACET[c] + 1 N-ACETYLNEURAMINATE[c]
- With common name(s):
- 1 H2O[c] + 1 N-acetyl-4-O-acetylneuraminate[c] => 1 H+[c] + 1 acetate[c] + 1 N-acetylneuraminate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_17029
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4419
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4418
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- RHEA: