Difference between revisions of "Tiso gene 7622"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] == * smiles: ** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C * inchi key: ** InChIKey=HII...")
(Created page with "Category:Gene == Gene Tiso_gene_7622 == * Synonym(s): == Reactions associated == * Reaction: 2.1.1.79-RXN ** Source: orthology-esiliculosus * Reaction: RXN1G-25...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7100 CPD-7100] ==
+
== Gene Tiso_gene_7622 ==
−
* smiles:
+
−
** CC(C(C(=O)[O-])C(=O)C(=O)[O-])C
+
−
* inchi key:
+
−
** InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L
+
−
* common name:
+
−
** (2S)-2-isopropyl-3-oxosuccinate
+
−
* molecular weight:
+
−
** 172.137   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-isopropyl-3-oxosuccinate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7800]]
+
* Reaction: [[2.1.1.79-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[IMDH]]
+
* Reaction: [[RXN1G-2544]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-esiliculosus]]
−
* [[3-ISOPROPYLMALDEHYDROG-RXN]]
+
* Reaction: [[RXN1G-3641]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-541]]
 +
* [[PWYG-321]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.1.1.79-RXN|RXN1G-2544|RXN1G-3641}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04236 C04236]
+
{{#set: pathway associated=PWY0-541|PWYG-321}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17214 17214]
+
−
* BIGG : 3c4mop
+
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6419705 6419705]
+
−
* HMDB : HMDB12149
+
−
{{#set: smiles=CC(C(C(=O)[O-])C(=O)C(=O)[O-])C}}
+
−
{{#set: inchi key=InChIKey=HIIZAGQWABAMRR-BYPYZUCNSA-L}}
+
−
{{#set: common name=(2S)-2-isopropyl-3-oxosuccinate}}
+
−
{{#set: molecular weight=172.137    }}
+
−
{{#set: common name=2-isopropyl-3-oxosuccinate}}
+
−
{{#set: consumed by=RXN-7800}}
+
−
{{#set: produced by=IMDH}}
+
−
{{#set: reversible reaction associated=3-ISOPROPYLMALDEHYDROG-RXN}}
+

Latest revision as of 21:14, 21 March 2018

Gene Tiso_gene_7622

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_7622&oldid=47026"