Difference between revisions of "Tiso gene 8110"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] == * smiles: ** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(...")
(Created page with "Category:Gene == Gene Tiso_gene_8110 == * right end position: ** 6298 * transcription direction: ** NEGATIVE * left end position: ** 3702 * centisome position: ** 35.23700...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8123 CPD-8123] ==
+
== Gene Tiso_gene_8110 ==
−
* smiles:
+
* right end position:
−
** C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))
+
** 6298
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** MoO2-molybdopterin cofactor
+
** 3702
−
* molecular weight:
+
* centisome position:
−
** 519.251    
+
** 35.237007    
 
* Synonym(s):
 
* Synonym(s):
−
** MoCo (dioxyo)
 
−
** molybdenum cofactor (dioxyo)
 
−
** MoO2(OH)Dtpp-mP
 
−
** {[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate
 
−
** MoO2-Mo-MPT
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-8348]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6298}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70680283 70680283]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: left end position=3702}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71302 71302]
+
{{#set: centisome position=35.237007   }}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C2(C1(S[Mo](=O)(=O)SC=1[CH]3([CH](O2)NC4(=C(N3)C(=O)NC(N)=N4))))}}
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
{{#set: inchi key=InChIKey=HDAJUGGARUFROU-JSUDGWJLSA-J}}
+
−
{{#set: common name=MoO2-molybdopterin cofactor}}
+
−
{{#set: molecular weight=519.251   }}
+
−
{{#set: common name=MoCo (dioxyo)|molybdenum cofactor (dioxyo)|MoO2(OH)Dtpp-mP|{[(5aR,8R,9aR)-2-amino-4-oxo-6,7-di(sulfanyl-κS)-1,5,5a,8,9a,10-hexahydro-4H-pyrano[3,2-g]pteridin-8-yl]methyl dihydrogenato(2-) phosphate}(dioxo)molybdate|MoO2-Mo-MPT}}
+
−
{{#set: produced by=RXN-8348}}
+

Latest revision as of 20:21, 21 March 2018

Gene Tiso_gene_8110

  • right end position:
    • 6298
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3702
  • centisome position:
    • 35.237007
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8110&oldid=41063"