Difference between revisions of "Tiso gene 8573"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)...")
(Created page with "Category:Gene == Gene Tiso_gene_8573 == * right end position: ** 2180 * transcription direction: ** POSITIVE * left end position: ** 407 * centisome position: ** 4.030501...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-139 CPD1F-139] ==
+
== Gene Tiso_gene_8573 ==
−
* smiles:
+
* right end position:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 2180
−
* common name:
+
* transcription direction:
−
** gibberellin A1
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M
+
** 407
−
* molecular weight:
+
* centisome position:
−
** 347.387    
+
** 4.030501    
 
* Synonym(s):
 
* Synonym(s):
−
** GA1
 
−
** gibberellin 1
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-115]]
+
* Reaction: [[2.3.1.97-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2180}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202506 25202506]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=407}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27717 27717]
+
{{#set: centisome position=4.030501   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.3.1.97-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00859 C00859]
+
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: common name=gibberellin A1}}
+
−
{{#set: inchi key=InChIKey=JLJLRLWOEMWYQK-SNTJWBGVSA-M}}
+
−
{{#set: molecular weight=347.387   }}
+
−
{{#set: common name=GA1|gibberellin 1}}
+
−
{{#set: consumed by=RXN-115}}
+

Latest revision as of 21:24, 21 March 2018

Gene Tiso_gene_8573

  • right end position:
    • 2180
  • transcription direction:
    • POSITIVE
  • left end position:
    • 407
  • centisome position:
    • 4.030501
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8573&oldid=48531"