Difference between revisions of "Tiso gene 8673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...") |
(Created page with "Category:Gene == Gene Tiso_gene_8673 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.67-RXN ** Source: orthology-athaliana ** Source: orthology-es...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_8673 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[2.4.1.67-RXN]] |
− | * [[RXN- | + | ** Source: [[orthology-athaliana]] |
− | + | ** Source: [[orthology-esiliculosus]] | |
− | * [[RXN- | + | ** Source: [[orthology-creinhardtii]] |
− | == | + | * Reaction: [[ALPHAGALACTOSID-RXN]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-11501]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-11502]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN-12088]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6527]] | ||
+ | * [[PWY0-1301]] | ||
+ | * [[PWY-5337]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.4.1.67-RXN|ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088}} | |
− | + | {{#set: pathway associated=PWY-6527|PWY0-1301|PWY-5337}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 21:06, 21 March 2018
Gene Tiso_gene_8673
- Synonym(s):
Reactions associated
- Reaction: 2.4.1.67-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: ALPHAGALACTOSID-RXN
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: RXN-11501
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: RXN-11502
- Source: orthology-creinhardtii
- Reaction: RXN-12088
- Source: orthology-esiliculosus