Difference between revisions of "Tiso gene 8673"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...")
 
(Created page with "Category:Gene == Gene Tiso_gene_8673 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.67-RXN ** Source: orthology-athaliana ** Source: orthology-es...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
+
== Gene Tiso_gene_8673 ==
−
* smiles:
+
−
** C(O)CC1(=CNC2(=C1C=C(O)C=C2))
+
−
* inchi key:
+
−
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
+
−
* common name:
+
−
** 5-hydroxytryptophol
+
−
* molecular weight:
+
−
** 177.202   
+
 
* Synonym(s):
 
* Synonym(s):
−
** hydroxytryptophol
 
−
** 5-hydroxyindole-3-ethanol
 
−
** 5-hydroxy-1H-indole-3-ethanol
 
−
** 1H-indole-3-ethanol, 5-hydroxy-
 
−
** indole-3-ethanol, 5-hydroxy-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10784]]
+
* Reaction: [[2.4.1.67-RXN]]
−
* [[RXN-10782]]
+
** Source: [[orthology-athaliana]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
−
* [[RXN-10781]]
+
** Source: [[orthology-creinhardtii]]
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[ALPHAGALACTOSID-RXN]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-11501]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-11502]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-12088]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-6527]]
 +
* [[PWY0-1301]]
 +
* [[PWY-5337]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=2.4.1.67-RXN|ALPHAGALACTOSID-RXN|RXN-11501|RXN-11502|RXN-12088}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061]
+
{{#set: pathway associated=PWY-6527|PWY0-1301|PWY-5337}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.8708.html 8708]
+
−
* HMDB : HMDB01855
+
−
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}}
+
−
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=5-hydroxytryptophol}}
+
−
{{#set: molecular weight=177.202    }}
+
−
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}}
+
−
{{#set: consumed by=RXN-10784|RXN-10782}}
+
−
{{#set: produced by=RXN-10781}}
+

Latest revision as of 21:06, 21 March 2018

Gene Tiso_gene_8673

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8673&oldid=45951"