Difference between revisions of "Tiso gene 9118"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_16492 == * left end position: ** 2429 * transcription direction: ** POSITIVE * right end position: ** 3862 * centisome position: ** 56.2138...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_16492 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] ==
−
* left end position:
+
* smiles:
−
** 2429
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 5α-cholesta-8-en-3-one
−
* right end position:
+
* inchi key:
−
** 3862
+
** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
−
* centisome position:
+
* molecular weight:
−
** 56.213837    
+
** 384.644    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[RXN0-2601]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
* [[RXN66-23]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2429}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324]
−
{{#set: right end position=3862}}
+
* CHEBI:
−
{{#set: centisome position=56.213837   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056]
−
{{#set: reaction associated=RXN0-2601}}
+
* HMDB : HMDB12178
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}}
 +
{{#set: common name=5α-cholesta-8-en-3-one}}
 +
{{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}}
 +
{{#set: molecular weight=384.644   }}
 +
{{#set: produced by=RXN66-23}}

Revision as of 16:38, 21 March 2018

Metabolite CPD-8620

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
  • common name:
    • 5α-cholesta-8-en-3-one
  • inchi key:
    • InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
  • molecular weight:
    • 384.644
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9118&oldid=35354"