Difference between revisions of "Tiso gene 9885"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * inchi key: ** InChIKey...")
 
(Created page with "Category:Gene == Gene Tiso_gene_6741 == * left end position: ** 121 * transcription direction: ** POSITIVE * right end position: ** 1104 * centisome position: ** 1.01809...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
+
== Gene Tiso_gene_6741 ==
−
* smiles:
+
* left end position:
−
** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
+
** 121
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** β-L-arabinose 1-phosphate
+
** 1104
−
* molecular weight:
+
* centisome position:
−
** 228.095    
+
** 1.01809    
 
* Synonym(s):
 
* Synonym(s):
−
** β-L-arabinose 1-P
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[UMPU]]
+
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=121}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1104}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521]
+
{{#set: centisome position=1.01809   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=RNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906]
+
−
* HMDB : HMDB12195
+
−
{{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}}
+
−
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}}
+
−
{{#set: common name=β-L-arabinose 1-phosphate}}
+
−
{{#set: molecular weight=228.095   }}
+
−
{{#set: common name=β-L-arabinose 1-P}}
+
−
{{#set: consumed by=UMPU}}
+

Revision as of 17:53, 10 January 2018

Gene Tiso_gene_6741

  • left end position:
    • 121
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1104
  • centisome position:
    • 1.01809
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9885&oldid=15138"