Difference between revisions of "Tiso gene 9915"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] == * smiles: ** CC(C)(CO)C(C([O-])=O)O * inchi key: ** InChIKey=OTOIIPJY...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-395 RXN1G-395] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-eicos-2-enoyl-[acyl-c...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-PANTOATE L-PANTOATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-395 RXN1G-395] ==
−
* smiles:
+
* direction:
−
** CC(C)(CO)C(C([O-])=O)O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M
+
 
* common name:
 
* common name:
−
** (R)-pantoate
+
** trans-eicos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
* ec number:
−
** 147.15   
+
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
−
** pantoate
 
−
** L-pantoate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[trans-delta2-arachidoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Arachidoyl-ACPs]][c]
−
* [[2-DEHYDROPANTOATE-REDUCT-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 a trans-eicos-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''=>''' 1 NAD+[c] '''+''' 1 an arachidoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10778]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 470-29-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* DRUGBANK : DB01930
+
{{#set: common name=trans-eicos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.9}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289105 5289105]
+
{{#set: gene associated=Tiso_gene_10778}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWYG-321}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00522 C00522]
+
{{#set: reconstruction category=orthology}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
** [http://www.chemspider.com/Chemical-Structure.4451134.html 4451134]
+
{{#set: reconstruction tool=pantograph}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15980 15980]
+
−
* BIGG : pant__R
+
−
{{#set: smiles=CC(C)(CO)C(C([O-])=O)O}}
+
−
{{#set: inchi key=InChIKey=OTOIIPJYVQJATP-BYPYZUCNSA-M}}
+
−
{{#set: common name=(R)-pantoate}}
+
−
{{#set: molecular weight=147.15    }}
+
−
{{#set: common name=pantoate|L-pantoate}}
+
−
{{#set: consumed by=PANTOATE-BETA-ALANINE-LIG-RXN}}
+
−
{{#set: produced by=2-DEHYDROPANTOATE-REDUCT-RXN}}
+

Revision as of 16:35, 21 March 2018

Reaction RXN1G-395

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-eicos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"trans-eicos-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_9915&oldid=35068"