Difference between revisions of "TransportSeed CARBON-DIOXIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8828 == * Synonym(s): == Reactions associated == * AMETt2h ** pantograph-creinhardtii * AMETt2m ** pantograph-creinh...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8828 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
 +
* smiles:
 +
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
 +
* inchi key:
 +
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
 +
* common name:
 +
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
 +
* molecular weight:
 +
** 519.151   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3',8-cH2GTP
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[AMETt2h]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN-8340]]
* [[AMETt2m]]
+
== Reaction(s) of unknown directionality ==
** [[pantograph]]-[[creinhardtii]]
+
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: reaction associated=AMETt2h|AMETt2m}}
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
 +
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
 +
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
 +
{{#set: molecular weight=519.151    }}
 +
{{#set: common name=3',8-cH2GTP}}
 +
{{#set: produced by=RXN-8340}}

Revision as of 18:08, 10 January 2018

Metabolite CPD-19179

  • smiles:
    • C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
  • inchi key:
    • InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
  • common name:
    • (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
  • molecular weight:
    • 519.151
  • Synonym(s):
    • 3',8-cH2GTP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))" cannot be used as a page name in this wiki.