Difference between revisions of "TransportSeed THIAMINE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] == * direction: ** REVERSIBLE * common name: ** 3-hydroxy-L-kynurenine-oxoglut...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] == * smiles: ** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3945 CPD-3945] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** 3-hydroxy-L-kynurenine-oxoglutarate transaminase
+
** (22α)-hydroxy-campest-4-en-3-one
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.6.1.7 EC-2.6.1.7]
+
** InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
 +
* molecular weight:
 +
** 414.67   
 
* Synonym(s):
 
* Synonym(s):
 +
** (22S)-22-hydroxy-campest-4-en-3-one
 +
** (22S,24R)-22-hydroxy-ergost-4-en-3-one
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[3-HYDROXY-L-KYNURENINE]][c] '''+''' 1 [[2-KETOGLUTARATE]][c] '''<=>''' 1 [[CPD-11552]][c] '''+''' 1 [[GLT]][c]
+
* [[RXN-4231]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 3-hydroxy-L-kynurenine[c] '''+''' 1 2-oxoglutarate[c] '''<=>''' 1 4-(2-amino-3-hydroxyphenyl)-2,4-dioxobutanoate[c] '''+''' 1 L-glutamate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15680]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309]
+
−
** '''9''' reactions found over '''17''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* LIPID_MAPS : LMST01031116
−
** [http://www.genome.jp/dbget-bin/www_bget?R04171 R04171]
+
* PUBCHEM:
−
{{#set: direction=REVERSIBLE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15341631 15341631]
−
{{#set: common name=3-hydroxy-L-kynurenine-oxoglutarate transaminase}}
+
* HMDB : HMDB12113
−
{{#set: ec number=EC-2.6.1.7}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_15680}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=72330 72330]
−
{{#set: in pathway=PWY-6309}}
+
* LIGAND-CPD:
−
{{#set: reconstruction category=orthology}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C15796 C15796]
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: smiles=CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=(22&alpha;)-hydroxy-campest-4-en-3-one}}
 +
{{#set: inchi key=InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N}}
 +
{{#set: molecular weight=414.67    }}
 +
{{#set: common name=(22S)-22-hydroxy-campest-4-en-3-one|(22S,24R)-22-hydroxy-ergost-4-en-3-one}}
 +
{{#set: produced by=RXN-4231}}

Revision as of 15:55, 21 March 2018

Metabolite CPD-3945

  • smiles:
    • CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • (22α)-hydroxy-campest-4-en-3-one
  • inchi key:
    • InChIKey=FMFAICDKESPFNH-NQMBQAPESA-N
  • molecular weight:
    • 414.67
  • Synonym(s):
    • (22S)-22-hydroxy-campest-4-en-3-one
    • (22S,24R)-22-hydroxy-ergost-4-en-3-one

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMST01031116
  • PUBCHEM:
  • HMDB : HMDB12113
  • CHEBI:
  • LIGAND-CPD:
"CC(C)C(C)CC(O)C(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TransportSeed_THIAMINE&oldid=31262"