Difference between revisions of "URACIL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PLASMENYLCHOLINE PLASMENYLCHOLINE] == * common name: ** a plasmenylcholine * Synonym(s): ** an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] == * smiles: ** C1(=CC(NC(=O)N1)=O) * common name: ** uracil * inchi key: ** InC...") |
||
(4 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] == |
+ | * smiles: | ||
+ | ** C1(=CC(NC(=O)N1)=O) | ||
* common name: | * common name: | ||
− | ** | + | ** uracil |
+ | * inchi key: | ||
+ | ** InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 112.088 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** U |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[URACIL-PRIBOSYLTRANS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[URIDINE-NUCLEOSIDASE-RXN]] | ||
+ | * [[RXN0-2584]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[URANA1t]] | ||
+ | * [[URPHOS-RXN]] | ||
+ | * [[URA-PHOSPH-RXN]] | ||
+ | * [[RXN0-5398]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 66-22-8 |
− | {{#set: common name= | + | * BIGG : ura |
− | {{#set: | + | * DRUGBANK : DB03419 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1174 1174] | ||
+ | * HMDB : HMDB00300 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00106 C00106] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.1141.html 1141] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17568 17568] | ||
+ | * METABOLIGHTS : MTBLC17568 | ||
+ | {{#set: smiles=C1(=CC(NC(=O)N1)=O)}} | ||
+ | {{#set: common name=uracil}} | ||
+ | {{#set: inchi key=InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=112.088 }} | ||
+ | {{#set: common name=U}} | ||
+ | {{#set: consumed by=URACIL-PRIBOSYLTRANS-RXN}} | ||
+ | {{#set: produced by=URIDINE-NUCLEOSIDASE-RXN|RXN0-2584}} | ||
+ | {{#set: reversible reaction associated=URANA1t|URPHOS-RXN|URA-PHOSPH-RXN|RXN0-5398}} |
Latest revision as of 20:34, 21 March 2018
Contents
Metabolite URACIL
- smiles:
- C1(=CC(NC(=O)N1)=O)
- common name:
- uracil
- inchi key:
- InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N
- molecular weight:
- 112.088
- Synonym(s):
- U
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 66-22-8
- BIGG : ura
- DRUGBANK : DB03419
- PUBCHEM:
- HMDB : HMDB00300
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC17568