Difference between revisions of "RXN-16317"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1242 CPD-1242] == * smiles: ** C(O)C1(OC(C(C(C1O)=O)O)O) * inchi key: ** InChIKey=APIQNBNBI...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16317 RXN-16317] == * direction: ** REVERSIBLE * common name: ** Mitogen-activated protein kina...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16317 RXN-16317] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Mitogen-activated protein kinase kinase 6, MPKK6 |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.7.12.2 EC-2.7.12.2] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[MAP-Kinase-L-Tyr]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[MAP-Kinase-L-Phosphotyrosine]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a [mitogen-activated protein kinase]-L-tyrosine[c] '''+''' 1 ATP[c] '''<=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 a [mitogen-activated protein kinase] L-tyrosine phosphate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00008752001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00008994001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=Mitogen-activated protein kinase kinase 6, MPKK6}} | |
− | + | {{#set: ec number=EC-2.7.12.2}} | |
− | + | {{#set: gene associated=CHC_T00008752001|CHC_T00008994001_1}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 14:50, 23 May 2018
Contents
Reaction RXN-16317
- direction:
- REVERSIBLE
- common name:
- Mitogen-activated protein kinase kinase 6, MPKK6
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MAP-Kinase-L-Tyr[c] + 1 ATP[c] <=> 1 ADP[c] + 1 PROTON[c] + 1 MAP-Kinase-L-Phosphotyrosine[c]
- With common name(s):
- 1 a [mitogen-activated protein kinase]-L-tyrosine[c] + 1 ATP[c] <=> 1 ADP[c] + 1 H+[c] + 1 a [mitogen-activated protein kinase] L-tyrosine phosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008752001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00008994001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome