Difference between revisions of "RXN-13322"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-782 CPD-782] == * smiles: ** C([O-])(=O)CC1(C=CC(=C(C=1)O)O) * inchi key: ** InChIKey=CFFZD...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13322 RXN-13322] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-ketoacyl-CoA synthase * e...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13322 RXN-13322] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 3 | + | ** 3-ketoacyl-CoA synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[OLEOYL-COA]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-14300]][c] |
− | == | + | * With common name(s): |
+ | ** 1 oleoyl-CoA[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 H+[c] '''=>''' 1 coenzyme A[c] '''+''' 1 CO2[c] '''+''' 1 3-oxo-(11Z)-eicos-11-enoyl-CoA[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[CHC_T00009104001]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[CHC_T00009104001_1]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6433]], hydroxylated fatty acid biosynthesis (plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6433 PWY-6433] | ||
+ | ** '''7''' reactions found over '''22''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-original_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-ketoacyl-CoA synthase}} | |
− | + | {{#set: ec number=EC-2.3.1.199}} | |
− | + | {{#set: gene associated=CHC_T00009104001|CHC_T00009104001_1}} | |
− | + | {{#set: in pathway=PWY-6433}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-original_genome|orthology-ectocarpus_siliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 14:51, 23 May 2018
Contents
Reaction RXN-13322
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-ketoacyl-CoA synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 OLEOYL-COA[c] + 1 MALONYL-COA[c] + 1 PROTON[c] => 1 CO-A[c] + 1 CARBON-DIOXIDE[c] + 1 CPD-14300[c]
- With common name(s):
- 1 oleoyl-CoA[c] + 1 malonyl-CoA[c] + 1 H+[c] => 1 coenzyme A[c] + 1 CO2[c] + 1 3-oxo-(11Z)-eicos-11-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009104001
- Source: annotation-original_genome
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-original_genome
- Gene: CHC_T00009104001_1
- Source: orthology-ectocarpus_siliculosus
Pathways
- PWY-6433, hydroxylated fatty acid biosynthesis (plants): PWY-6433
- 7 reactions found over 22 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-ectocarpus_siliculosus
- Tool: pantograph
- Source: orthology-ectocarpus_siliculosus
- Category: annotation
- Source: annotation-original_genome
- Tool: pathwaytools
- Source: annotation-original_genome