Difference between revisions of "N-Acylated-Amino-Acids"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18776 CPD-18776] == * smiles: ** COC1(C(=O)CC(CO)(O)CC(O)=1) * common name: ** (R)-4-deoxyg...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] == * common name: ** an N-acylated amino acid *...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-Acylated-Amino-Acids N-Acylated-Amino-Acids] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** an N-acylated amino acid |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** a N-acyl-amino acid | ||
+ | ** an N-acyl-L-amino acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[ACYLAMINOACYL-PEPTIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: | + | {{#set: common name=an N-acylated amino acid}} |
− | {{#set: common name= | + | {{#set: common name=a N-acyl-amino acid|an N-acyl-L-amino acid}} |
− | + | {{#set: produced by=ACYLAMINOACYL-PEPTIDASE-RXN}} | |
− | + | ||
− | {{#set: produced by= | + | |
− | + |
Latest revision as of 14:52, 23 May 2018
Contents
Metabolite N-Acylated-Amino-Acids
- common name:
- an N-acylated amino acid
- Synonym(s):
- a N-acyl-amino acid
- an N-acyl-L-amino acid