Difference between revisions of "CHC T00006845001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00006845001_1 == * Synonym(s): == Reactions associated == * Reaction: 2.7.11.2-RXN ** Source: orthology-galdieria.sulphuraria == Pathwa...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00006845001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[2.7.11.2-RXN]] | |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | * [[ | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: reaction associated=2.7.11.2-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + |
Latest revision as of 14:53, 23 May 2018
Gene CHC_T00006845001_1
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.2-RXN
- Source: orthology-galdieria.sulphuraria