Difference between revisions of "PWY-6122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11690 CPD-11690] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(CO)O * inchi key: ** InChIKey=R...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6122 PWY-6122] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157] |
| − | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | * | + | |
* common name: | * common name: | ||
| − | ** | + | ** 5-aminoimidazole ribonucleotide biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[RXN- | + | '''5''' reactions found over '''5''' reactions in the full pathway |
| − | + | * [[AIRS-RXN]] | |
| − | == Reaction(s) | + | ** 2 associated gene(s): |
| + | *** [[CHC_T00008410001_1]] | ||
| + | *** [[CHC_T00008410001]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[FGAMSYN-RXN]] | ||
| + | ** 2 associated gene(s): | ||
| + | *** [[CHC_T00008585001]] | ||
| + | *** [[CHC_T00008585001_1]] | ||
| + | ** 4 reconstruction source(s) associated: | ||
| + | *** [[annotation-original_genome]] | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[GARTRANSFORMYL2-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00006609001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[GLYRIBONUCSYN-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00000892001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | * [[PRPPAMIDOTRANS-RXN]] | ||
| + | ** 1 associated gene(s): | ||
| + | *** [[CHC_T00009506001_1]] | ||
| + | ** 3 reconstruction source(s) associated: | ||
| + | *** [[orthology-arabidopsis_thaliana]] | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | *** [[orthology-galdieria.sulphuraria]] | ||
| + | == Reaction(s) not found == | ||
== External links == | == External links == | ||
| − | * | + | * ECOCYC: |
| − | ** [http:// | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6122 PWY-6122] |
| − | + | {{#set: taxonomic range=TAX-2157}} | |
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=5-aminoimidazole ribonucleotide biosynthesis II}} | |
| − | + | {{#set: reaction found=5}} | |
| − | + | {{#set: total reaction=5}} | |
| − | {{#set: | + | {{#set: completion rate=100.0}} |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 14:54, 23 May 2018
Pathway PWY-6122
- taxonomic range:
- common name:
- 5-aminoimidazole ribonucleotide biosynthesis II
- Synonym(s):
Reaction(s) found
5 reactions found over 5 reactions in the full pathway
- AIRS-RXN
- 2 associated gene(s):
- 2 reconstruction source(s) associated:
- FGAMSYN-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- GARTRANSFORMYL2-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
- GLYRIBONUCSYN-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
- PRPPAMIDOTRANS-RXN
- 1 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC:
