Difference between revisions of "PWY0-1545"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] == * smiles: ** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4)) *...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] == * common name: ** cardiolipin biosynthesis III * Synonym(s): == Reaction(s)...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-27 CPD66-27] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1545 PWY0-1545] ==
* smiles:
+
** CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))
+
* inchi key:
+
** InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** pregn-5-ene-3,20-dione-17-ol
+
** cardiolipin biosynthesis III
* molecular weight:
+
** 330.466   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[PHOSPHAGLYPSYN-RXN]]
* [[RXN66-350]]
+
** 4 associated gene(s):
 +
*** [[CHC_T00008428001]]
 +
*** [[CHC_T00009507001_1]]
 +
*** [[CHC_T00009507001]]
 +
*** [[CHC_T00008428001_1]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-original_genome]]
 +
*** [[orthology-arabidopsis_thaliana]]
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
*** [[orthology-galdieria.sulphuraria]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PGPPHOSPHA-RXN PGPPHOSPHA-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7012 RXN0-7012]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14562950 14562950]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1545 PWY0-1545]
{{#set: smiles=CC(=O)C4(O)(CCC2(C(C)(CCC1(C3(C)(C(=CCC12)CC(=O)CC3)))4))}}
+
{{#set: common name=cardiolipin biosynthesis III}}
{{#set: inchi key=InChIKey=RCFJDVCRANOZEL-UHFFFAOYSA-N}}
+
{{#set: reaction found=1}}
{{#set: common name=pregn-5-ene-3,20-dione-17-ol}}
+
{{#set: total reaction=3}}
{{#set: molecular weight=330.466    }}
+
{{#set: completion rate=33.0}}
{{#set: consumed or produced by=RXN66-350}}
+

Revision as of 14:54, 23 May 2018

Pathway PWY0-1545

  • common name:
    • cardiolipin biosynthesis III
  • Synonym(s):

Reaction(s) found

1 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links