Difference between revisions of "RXN-16332"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16332 RXN-16332] ==
−
* smiles:
+
* direction:
−
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
+
** [http://enzyme.expasy.org/EC/1.14.19.17 EC-1.14.19.17]
−
* common name:
+
−
** ergosta-5,7,24(28)-trien-3β-ol
+
−
* molecular weight:
+
−
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 5,7,24(28)-ergostatrienol
 
−
** 5-dehydro episterol
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN3O-218]]
+
** 2 [[PROTON]][c] '''+''' 1 [[CPD3DJ-82]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''=>''' 2 [[WATER]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 1 [[N-Acylsphingosine]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 2 H+[c] '''+''' 1 a dihydroceramide[c] '''+''' 1 oxygen[c] '''+''' 2 a ferrocytochrome b5[c] '''=>''' 2 H2O[c] '''+''' 2 a ferricytochrome b5[c] '''+''' 1 a sphingosine ceramide[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009401001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
* [[PWY3DJ-12]], ceramide de novo biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-12 PWY3DJ-12]
 +
** '''3''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
+
{{#set: ec number=EC-1.14.19.17}}
−
* HMDB : HMDB06848
+
{{#set: gene associated=CHC_T00009401001_1}}
−
* CHEBI:
+
{{#set: in pathway=PWY3DJ-12}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
−
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
+
−
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
+
−
{{#set: molecular weight=396.655    }}
+
−
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
+
−
{{#set: produced by=RXN3O-218}}
+

Latest revision as of 14:55, 23 May 2018

Reaction RXN-16332

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY3DJ-12, ceramide de novo biosynthesis: PWY3DJ-12
    • 3 reactions found over 4 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-16332&oldid=12590"