Difference between revisions of "RXN-11919"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * inchi key: ** InChIKey=VISAJ...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == * direction: ** LEFT-TO-RIGHT * common name: ** (2E)-5-methylhexa-2,4-dieno...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11919 RXN-11919] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (2E)-5-methylhexa-2,4-dienoyl-CoA hydratase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/4.2.1 EC-4.2.1] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-12904]][c] '''=>''' 1 [[CPD-12905]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 (2E)-5-methylhexa-2,4-dienoyl-CoA[c] '''=>''' 1 3-hydroxy-5-methylhex-4-enoyl-CoA[c] |
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00009110001_1]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | == Pathways == | ||
| + | * [[PWY-6672]], cis-genanyl-CoA degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6672 PWY-6672] | ||
| + | ** '''4''' reactions found over '''9''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-arabidopsis_thaliana]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R08093 R08093] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=(2E)-5-methylhexa-2,4-dienoyl-CoA hydratase}} | |
| − | * LIGAND- | + | {{#set: ec number=EC-4.2.1}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: gene associated=CHC_T00009110001_1}} |
| − | + | {{#set: in pathway=PWY-6672}} | |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-arabidopsis_thaliana}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 14:56, 23 May 2018
Contents
Reaction RXN-11919
- direction:
- LEFT-TO-RIGHT
- common name:
- (2E)-5-methylhexa-2,4-dienoyl-CoA hydratase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 (2E)-5-methylhexa-2,4-dienoyl-CoA[c] => 1 3-hydroxy-5-methylhex-4-enoyl-CoA[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00009110001_1
- Source: orthology-arabidopsis_thaliana
Pathways
- PWY-6672, cis-genanyl-CoA degradation: PWY-6672
- 4 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-arabidopsis_thaliana
- Tool: pantograph
- Source: orthology-arabidopsis_thaliana
External links
- LIGAND-RXN:
