Difference between revisions of "Octadec-2-enoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] == * common name: ** a trans-octadec-2-enoyl-[acp] *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Octadec-2-enoyl-ACPs Octadec-2-enoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a trans-octadec-2-enoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trans-2,3-stearoyl-[acp] |
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9635]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9634]] |
| − | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a trans-octadec-2-enoyl-[acp]}} | |
| − | + | {{#set: common name=trans-2,3-stearoyl-[acp]}} | |
| − | + | {{#set: consumed by=RXN-9635}} | |
| − | + | {{#set: produced by=RXN-9634}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by=RXN- | + | |
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 14:57, 23 May 2018
Contents
Metabolite Octadec-2-enoyl-ACPs
- common name:
- a trans-octadec-2-enoyl-[acp]
- Synonym(s):
- trans-2,3-stearoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a trans-octadec-2-enoyl-[acp" cannot be used as a page name in this wiki.
"trans-2,3-stearoyl-[acp" cannot be used as a page name in this wiki.
