Difference between revisions of "CYS-GLY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4575 CPD-4575] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(C(CO)(C)C(O)CCC(C)1C=2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == * smiles: ** C(C([O-])=O)NC(C(CS)[N+])=O * inchi key: ** InChIKey=ZUKPVRWZD...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYS-GLY CYS-GLY] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(C([O-])=O)NC(C(CS)[N+])=O |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N |
* common name: | * common name: | ||
| − | ** | + | ** L-cysteinyl-glycine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 178.206 |
* Synonym(s): | * Synonym(s): | ||
| + | ** Cys-Gly | ||
| + | ** cysteinylglycine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-6622]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-6601]] |
| + | * [[RXN-9157]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * BIGG : cgly | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098621 7098621] |
| + | * HMDB : HMDB00078 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01419 C01419] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61694 61694] |
| − | * | + | * METABOLIGHTS : MTBLC4047 |
| − | {{#set: smiles= | + | {{#set: smiles=C(C([O-])=O)NC(C(CS)[N+])=O}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N}} |
| − | {{#set: common name= | + | {{#set: common name=L-cysteinyl-glycine}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=178.206 }} |
| − | {{#set: consumed by= | + | {{#set: common name=Cys-Gly|cysteinylglycine}} |
| − | {{#set: produced by= | + | {{#set: consumed by=RXN-6622}} |
| + | {{#set: produced by=RXN-6601|RXN-9157}} | ||
Revision as of 14:57, 23 May 2018
Contents
Metabolite CYS-GLY
- smiles:
- C(C([O-])=O)NC(C(CS)[N+])=O
- inchi key:
- InChIKey=ZUKPVRWZDMRIEO-VKHMYHEASA-N
- common name:
- L-cysteinyl-glycine
- molecular weight:
- 178.206
- Synonym(s):
- Cys-Gly
- cysteinylglycine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : cgly
- PUBCHEM:
- HMDB : HMDB00078
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC4047
"C(C([O-])=O)NC(C(CS)[N+])=O" cannot be used as a page name in this wiki.
