Difference between revisions of "Methyl-Jasmonates"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLC-6-P GLC-6-P] == * smiles: ** C(C1(OC(C(C(C1O)O)O)O))OP([O-])([O-])=O * inchi key: ** InChIK...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-Jasmonates Methyl-Jasmonates] == * common name: ** a methyl jasmonate * Synonym(s): ** a...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Methyl-Jasmonates Methyl-Jasmonates] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a methyl jasmonate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a jasmonic acid methyl ester |
| + | ** a jasmonate methyl ester | ||
| + | ** an MeJA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10767]] |
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=a methyl jasmonate}} | |
| − | + | {{#set: common name=a jasmonic acid methyl ester|a jasmonate methyl ester|an MeJA}} | |
| − | + | {{#set: consumed by=RXN-10767}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed | + | |
Latest revision as of 14:58, 23 May 2018
Contents
Metabolite Methyl-Jasmonates
- common name:
- a methyl jasmonate
- Synonym(s):
- a jasmonic acid methyl ester
- a jasmonate methyl ester
- an MeJA
