Difference between revisions of "CHC T00008585001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
(Created page with "Category:Gene == Gene CHC_T00008585001_1 == * Synonym(s): == Reactions associated == * Reaction: FGAMSYN-RXN ** Source: orthology-galdieria.sulphuraria ** Source:...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Gene CHC_T00008585001_1 ==
−
* smiles:
+
−
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
−
* inchi key:
+
−
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
−
* common name:
+
−
** FAD
+
−
* molecular weight:
+
−
** 782.533   
+
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide oxidized
 
−
** flavin adenine dinucleotide
 
−
** flavitan
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[FGAMSYN-RXN]]
−
* [[FADSYN-RXN]]
+
** Source: [[orthology-galdieria.sulphuraria]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
* [[RXN-14264]]
+
** Source: [[orthology-arabidopsis_thaliana]]
 +
== Pathways associated ==
 +
* [[PWY-6121]]
 +
* [[PWY-6122]]
 +
* [[PWY-6277]]
 
== External links  ==
 
== External links  ==
−
* CAS : 146-14-5
+
{{#set: reaction associated=FGAMSYN-RXN}}
−
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: pathway associated=PWY-6121|PWY-6122|PWY-6277}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
−
* HMDB : HMDB01248
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
−
* BIGG : fad
+
−
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
−
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
−
{{#set: common name=FAD}}
+
−
{{#set: molecular weight=782.533    }}
+
−
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
−
{{#set: produced by=FADSYN-RXN}}
+
−
{{#set: consumed or produced by=RXN-14264}}
+

Revision as of 14:59, 23 May 2018

Gene CHC_T00008585001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008585001_1&oldid=12829"