Difference between revisions of "RXN-13709"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13709 RXN-13709] == * direction: ** LEFT-TO-RIGHT * common name: ** 4-methylsterol monooxygenas...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13709 RXN-13709] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I
+
 
* common name:
 
* common name:
−
** (E)-2-benzylidenesuccinyl-CoA
+
** 4-methylsterol monooxygenase
−
* molecular weight:
+
* ec number:
−
** 950.677   
+
** [http://enzyme.expasy.org/EC/1.14.13.72 EC-1.14.13.72]
 
* Synonym(s):
 
* Synonym(s):
−
** E-phenylitaconyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-902]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 3 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''+''' 3 [[NADH-P-OR-NOP]][c] '''+''' 1 [[4-METHYL-824-CHOLESTADIENOL]][c] '''=>''' 1 [[CPD-4702]][c] '''+''' 4 [[WATER]][c] '''+''' 3 [[NAD-P-OR-NOP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 3 oxygen[c] '''+''' 2 H+[c] '''+''' 3 NAD(P)H[c] '''+''' 1 4α-methyl-zymosterol[c] '''=>''' 1 4α-carboxy-5α-cholesta-8,24-dien-3β-ol[c] '''+''' 4 H2O[c] '''+''' 3 NAD(P)+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00010320001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986140 50986140]
+
{{#set: common name=4-methylsterol monooxygenase}}
−
* CHEBI:
+
{{#set: ec number=EC-1.14.13.72}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27639 27639]
+
{{#set: gene associated=CHC_T00010320001_1}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09818 C09818]
+
{{#set: reconstruction category=orthology}}
−
* HMDB : HMDB12223
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(CC(=O)[O-])=CC1(C=CC=CC=1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=CIZCKPNGZPENDV-UMUUVTGISA-I}}
+
−
{{#set: common name=(E)-2-benzylidenesuccinyl-CoA}}
+
−
{{#set: molecular weight=950.677    }}
+
−
{{#set: common name=E-phenylitaconyl-CoA}}
+
−
{{#set: consumed by=RXN-902}}
+

Latest revision as of 16:01, 23 May 2018

Reaction RXN-13709

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 4-methylsterol monooxygenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-13709&oldid=12910"