Difference between revisions of "App-his-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PREPHENATE PREPHENATE] == * smiles: ** C(=O)([O-])C(=O)CC1(C(=O)[O-])(C=CC(O)C=C1) * inchi key:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=App-his-tRNAs App-his-tRNAs] == * common name: ** 5'-(5'-diphosphoadenosine)-ribonucleotide-[tR...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=App-his-tRNAs App-his-tRNAs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 5'-(5'-diphosphoadenosine)-ribonucleotide-[tRNAHis] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** App-tRNAHis | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-12504]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12503]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: common name=5'-(5'-diphosphoadenosine)-ribonucleotide-[tRNAHis]}} | |
| − | + | {{#set: common name=App-tRNAHis}} | |
| − | + | {{#set: consumed by=RXN-12504}} | |
| − | + | {{#set: produced by=RXN-12503}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | {{#set: consumed by= | + | |
| − | {{#set: | + | |
Latest revision as of 15:02, 23 May 2018
Contents
Metabolite App-his-tRNAs
- common name:
- 5'-(5'-diphosphoadenosine)-ribonucleotide-[tRNAHis]
- Synonym(s):
- App-tRNAHis
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"5'-(5'-diphosphoadenosine)-ribonucleotide-[tRNAHis" cannot be used as a page name in this wiki.
