Difference between revisions of "CHC T00000021001 1"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * inchi key: *...")
 
(Created page with "Category:Gene == Gene CHC_T00000021001_1 == * Synonym(s): == Reactions associated == * Reaction: MALTODEXGLUCOSID-RXN ** Source: orthology-ectocarpus_siliculosus...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] ==
+
== Gene CHC_T00000021001_1 ==
−
* smiles:
+
−
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O
+
−
* inchi key:
+
−
** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
+
−
* common name:
+
−
** S-sulfo-L-cysteine
+
−
* molecular weight:
+
−
** 200.204   
+
 
* Synonym(s):
 
* Synonym(s):
−
** S-sulfocysteine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[MALTODEXGLUCOSID-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-ectocarpus_siliculosus]]
−
* [[SULFOCYS-RXN]]
+
* Reaction: [[RXN-14281]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-14282]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-14283]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN-15910]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
* Reaction: [[RXN0-5183]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-842]]
 +
* [[GLYCOCAT-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: reaction associated=MALTODEXGLUCOSID-RXN|RXN-14281|RXN-14282|RXN-14283|RXN-15910|RXN0-5183}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408]
+
{{#set: pathway associated=PWY-842|GLYCOCAT-PWY}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62225 62225]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824]
+
−
* HMDB : HMDB00731
+
−
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}}
+
−
{{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}}
+
−
{{#set: common name=S-sulfo-L-cysteine}}
+
−
{{#set: molecular weight=200.204    }}
+
−
{{#set: common name=S-sulfocysteine}}
+
−
{{#set: consumed or produced by=SULFOCYS-RXN}}
+

Latest revision as of 16:02, 23 May 2018

Gene CHC_T00000021001_1

  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00000021001_1&oldid=12990"