Difference between revisions of "CPD-1099"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Deoxy-Ribonucleoside-Monophosphates Deoxy-Ribonucleoside-Monophosphates] == * common name: ** a...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] == * smiles: ** C(OC1(C(C(C(C(CO)O1)O)O)O))C2(C(C(C(C(O2)OC3(CO)(C(C(C(CO)O3...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1099 CPD-1099] == |
+ | * smiles: | ||
+ | ** C(OC1(C(C(C(C(CO)O1)O)O)O))C2(C(C(C(C(O2)OC3(CO)(C(C(C(CO)O3)O)O))O)O)O) | ||
+ | * inchi key: | ||
+ | ** InChIKey=MUPFEKGTMRGPLJ-ZQSKZDJDSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** raffinose |
+ | * molecular weight: | ||
+ | ** 504.441 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** melitose |
− | ** | + | ** melitriose |
− | ** | + | ** gossypose |
− | ** | + | ** 6G-α-D-galactosylsucrose |
− | ** | + | ** (2S,3R,4S,5S,6R)-2-[[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
+ | ** α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf | ||
+ | ** α-D-galactopyranosyl-(1->6)-α-D-glucopyranosyl-(1->2)-β-D-fructofuranoside | ||
+ | ** D-raffinose | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-11502]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11501]] |
− | * [[ | + | * [[2.4.1.82-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[2.4.1.67-RXN]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 512-69-6 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439242 439242] |
+ | * KEGG-GLYCAN : G00249 | ||
+ | * HMDB : HMDB03213 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00492 C00492] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.388379.html 388379] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16634 16634] | ||
+ | * METABOLIGHTS : MTBLC16634 | ||
+ | {{#set: smiles=C(OC1(C(C(C(C(CO)O1)O)O)O))C2(C(C(C(C(O2)OC3(CO)(C(C(C(CO)O3)O)O))O)O)O)}} | ||
+ | {{#set: inchi key=InChIKey=MUPFEKGTMRGPLJ-ZQSKZDJDSA-N}} | ||
+ | {{#set: common name=raffinose}} | ||
+ | {{#set: molecular weight=504.441 }} | ||
+ | {{#set: common name=melitose|melitriose|gossypose|6G-α-D-galactosylsucrose|(2S,3R,4S,5S,6R)-2-[[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol|α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf|α-D-galactopyranosyl-(1->6)-α-D-glucopyranosyl-(1->2)-β-D-fructofuranoside|D-raffinose}} | ||
+ | {{#set: consumed by=RXN-11502}} | ||
+ | {{#set: produced by=RXN-11501|2.4.1.82-RXN}} | ||
+ | {{#set: reversible reaction associated=2.4.1.67-RXN}} |
Revision as of 15:03, 23 May 2018
Contents
Metabolite CPD-1099
- smiles:
- C(OC1(C(C(C(C(CO)O1)O)O)O))C2(C(C(C(C(O2)OC3(CO)(C(C(C(CO)O3)O)O))O)O)O)
- inchi key:
- InChIKey=MUPFEKGTMRGPLJ-ZQSKZDJDSA-N
- common name:
- raffinose
- molecular weight:
- 504.441
- Synonym(s):
- melitose
- melitriose
- gossypose
- 6G-α-D-galactosylsucrose
- (2S,3R,4S,5S,6R)-2-[[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
- α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf
- α-D-galactopyranosyl-(1->6)-α-D-glucopyranosyl-(1->2)-β-D-fructofuranoside
- D-raffinose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 512-69-6
- PUBCHEM:
- KEGG-GLYCAN : G00249
- HMDB : HMDB03213
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16634
{{#set: common name=melitose|melitriose|gossypose|6G-α-D-galactosylsucrose|(2S,3R,4S,5S,6R)-2-[[(2R,3R,4S,5R,6R)-6-[(2S,3S,4R,5S)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-3,4,5-trihydroxy-oxan-2-yl]methoxy]-6-(hydroxymethyl)oxane-3,4,5-triol|α-D-Galp-(1->6)-α-D-Glcp-(1->2)-β-D-Fruf|α-D-galactopyranosyl-(1->6)-α-D-glucopyranosyl-(1->2)-β-D-fructofuranoside|D-raffinose}}