Difference between revisions of "PWY-6855"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] == * smiles: ** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O) * inchi key:...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NMNH NMNH] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6855 PWY-6855] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
* inchi key:
+
−
** InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L
+
 
* common name:
 
* common name:
−
** reduced β-nicotinamide D-ribonucleotide
+
** chitin degradation I (archaea)
−
* molecular weight:
+
−
** 334.222   
+
 
* Synonym(s):
 
* Synonym(s):
−
** nicotinamide mononucleotide (reduced)
+
** chitin degradation (archaea)
−
** NMNH
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''7''' reactions in the full pathway
−
* [[RXN0-4401]]
+
* [[3.2.1.14-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[CHC_T00004415001_1]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-ectocarpus_siliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINE-6-P-DEAMIN-RXN GLUCOSAMINE-6-P-DEAMIN-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN N-ACETYLGLUCOSAMINE-DEACETYLASE-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12309 RXN-12309]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12543 RXN-12543]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12544 RXN-12544]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-12545 RXN-12545]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246098 25246098]
+
{{#set: common name=chitin degradation I (archaea)}}
−
* CHEBI:
+
{{#set: common name=chitin degradation (archaea)}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90832 90832]
+
{{#set: reaction found=1}}
−
{{#set: smiles=C1(=C(CC=CN1C2(OC(COP(=O)([O-])[O-])C(O)C(O)2))C(N)=O)}}
+
{{#set: total reaction=7}}
−
{{#set: inchi key=InChIKey=XQHMUSRSLNRVGA-TURQNECASA-L}}
+
{{#set: completion rate=14.0}}
−
{{#set: common name=reduced β-nicotinamide D-ribonucleotide}}
+
−
{{#set: molecular weight=334.222    }}
+
−
{{#set: common name=nicotinamide mononucleotide (reduced)|NMNH}}
+
−
{{#set: produced by=RXN0-4401}}
+

Revision as of 15:03, 23 May 2018

Pathway PWY-6855

  • taxonomic range:
  • common name:
    • chitin degradation I (archaea)
  • Synonym(s):
    • chitin degradation (archaea)

Reaction(s) found

1 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6855&oldid=13027"