Difference between revisions of "CHC T00010204001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDINE URIDINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)) * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene CHC_T00010204001 == * left end position: ** 306190 * transcription direction: ** POSITIVE * right end position: ** 308949 * centisome position: ** 52...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00010204001 == |
| − | * | + | * left end position: |
| − | ** | + | ** 306190 |
| − | * | + | * transcription direction: |
| − | ** | + | ** POSITIVE |
| − | * | + | * right end position: |
| − | ** | + | ** 308949 |
| − | * | + | * centisome position: |
| − | ** | + | ** 52.206398 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[5.99.1.2-RXN]] |
| − | + | ** Source: [[annotation-original_genome]] | |
| − | * [[ | + | *** Assignment: automated-name-match |
| − | * | + | == Pathways associated == |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | + | {{#set: left end position=306190}} | |
| − | + | {{#set: transcription direction=POSITIVE}} | |
| − | + | {{#set: right end position=308949}} | |
| − | + | {{#set: centisome position=52.206398 }} | |
| − | + | {{#set: reaction associated=5.99.1.2-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
Latest revision as of 15:03, 23 May 2018
Gene CHC_T00010204001
- left end position:
- 306190
- transcription direction:
- POSITIVE
- right end position:
- 308949
- centisome position:
- 52.206398
- Synonym(s):
Reactions associated
- Reaction: 5.99.1.2-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome
