Difference between revisions of "RXN-12454"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12454 RXN-12454] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13758 CPD-13758] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12454 RXN-12454] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=OGAHROYMEOBORV-XONGILKKSA-J
+
** [http://enzyme.expasy.org/EC/1.3.1.88 EC-1.3.1.88]
* common name:
+
** 3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA
+
* molecular weight:
+
** 999.769   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-12750]]
+
** 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[Uracil16-in-tRNAs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[56-Dihydrouracil16-in-tRNAs]][c] '''+''' 1 [[NAD-P-OR-NOP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD(P)H[c] '''+''' 1 a uracil16 in tRNA[c] '''+''' 1 H+[c] '''=>''' 1 a 5,6-dihydrouracil16 in tRNA[c] '''+''' 1 NAD(P)+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009368001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657507 90657507]
+
{{#set: ec number=EC-1.3.1.88}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)CC(=O)C1(C(O)CCC2(C)(C(=O)CC[CH]12)))COP(=O)(OP(=O)(OCC3(C(OP([O-])(=O)[O-])C(O)C(O3)N5(C4(=C(C(N)=NC=N4)N=C5))))[O-])[O-]}}
+
{{#set: gene associated=CHC_T00009368001_1}}
{{#set: inchi key=InChIKey=OGAHROYMEOBORV-XONGILKKSA-J}}
+
{{#set: in pathway=}}
{{#set: common name=3-[(3aS,4S,5R,7aS)-5-hydroxy-7a-methyl-1-oxo-octahydro-1H-inden-4-yl]-3-oxopropanoyl-CoA}}
+
{{#set: reconstruction category=orthology}}
{{#set: molecular weight=999.769    }}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: produced by=RXN-12750}}
+
{{#set: reconstruction tool=pantograph}}

Latest revision as of 15:04, 23 May 2018

Reaction RXN-12454

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links