Difference between revisions of "RXN-9728"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9728 RXN-9728] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/2....") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9728 RXN-9728] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1 EC-2.3.1] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[MALONYL-COA]][c] '''+''' 1 [[Holo-malonate-decarboxylases]][c] '''=>''' 1 [[CO-A]][c] '''+''' 1 [[Malonate-Decarboxylases-Malonyl-Form]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 malonyl-CoA[c] '''+''' 1 [a holo malonate decarboxylase acyl-carrier-protein][c] '''=>''' 1 coenzyme A[c] '''+''' 1 a malonyl-[holo malonate decarboxylase acyl-carrier protein][c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[CHC_T00008765001_1]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | == Pathways == | ||
| + | * [[PWY-5794]], malonate degradation I (biotin-independent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5794 PWY-5794] | ||
| + | ** '''1''' reactions found over '''3''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-galdieria.sulphuraria]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: ec number=EC-2.3.1}} | |
| − | + | {{#set: gene associated=CHC_T00008765001_1}} | |
| − | + | {{#set: in pathway=PWY-5794}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-galdieria.sulphuraria}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 15:04, 23 May 2018
Contents
Reaction RXN-9728
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 MALONYL-COA[c] + 1 Holo-malonate-decarboxylases[c] => 1 CO-A[c] + 1 Malonate-Decarboxylases-Malonyl-Form[c]
- With common name(s):
- 1 malonyl-CoA[c] + 1 [a holo malonate decarboxylase acyl-carrier-protein][c] => 1 coenzyme A[c] + 1 a malonyl-[holo malonate decarboxylase acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: CHC_T00008765001_1
- Source: orthology-galdieria.sulphuraria
Pathways
- PWY-5794, malonate degradation I (biotin-independent): PWY-5794
- 1 reactions found over 3 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-galdieria.sulphuraria
- Tool: pantograph
- Source: orthology-galdieria.sulphuraria
