Difference between revisions of "PWY-6622"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] == * smiles: ** C(CC(=O)OCCC(C([O-])=O)[N+])C(...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6622 PWY-6622] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-SUCCINYL-L-HOMOSERINE O-SUCCINYL-L-HOMOSERINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6622 PWY-6622] ==
−
* smiles:
+
* taxonomic range:
−
** C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
−
** InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
−
** O-succinyl-L-homoserine
+
** heptadecane biosynthesis
−
* molecular weight:
+
−
** 218.186   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O-succinyl-homoserine
+
** alkane biosynthesis
−
** succinyl-homoserine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[METBALT-RXN]]
+
'''2''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[OCTADECANAL-DECARBONYLASE-RXN]]
−
* [[HOMSUCTRAN-RXN]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[O-SUCCHOMOSERLYASE-RXN]]
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
−
* [[RXN-9384]]
+
* [[RXN-11707]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13268 RXN-13268]
 
== External links  ==
 
== External links  ==
−
* CAS : 1492-23-5
+
{{#set: taxonomic range=TAX-33090}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878420 46878420]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: common name=heptadecane biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57661 57661]
+
{{#set: common name=alkane biosynthesis}}
−
* BIGG : suchms
+
{{#set: reaction found=2}}
−
* LIGAND-CPD:
+
{{#set: total reaction=3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01118 C01118]
+
{{#set: completion rate=67.0}}
−
{{#set: smiles=C(CC(=O)OCCC(C([O-])=O)[N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=GNISQJGXJIDKDJ-YFKPBYRVSA-M}}
+
−
{{#set: common name=O-succinyl-L-homoserine}}
+
−
{{#set: molecular weight=218.186    }}
+
−
{{#set: common name=O-succinyl-homoserine|succinyl-homoserine}}
+
−
{{#set: consumed by=METBALT-RXN}}
+
−
{{#set: produced by=HOMSUCTRAN-RXN}}
+
−
{{#set: consumed or produced by=O-SUCCHOMOSERLYASE-RXN|RXN-9384}}
+

Revision as of 16:05, 23 May 2018

Pathway PWY-6622

  • taxonomic range:
  • common name:
    • heptadecane biosynthesis
  • Synonym(s):
    • alkane biosynthesis

Reaction(s) found

2 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-6622&oldid=13170"