Difference between revisions of "CHC T00008683001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] == * smiles: ** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2) * in...")
(Created page with "Category:Gene == Gene CHC_T00008683001 == * left end position: ** 166092 * transcription direction: ** POSITIVE * right end position: ** 167656 * centisome position: ** 88...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2500 CPD0-2500] ==
+
== Gene CHC_T00008683001 ==
−
* smiles:
+
* left end position:
−
** C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)
+
** 166092
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** p-nitrophenyl-α-D-galactopyranoside
+
** 167656
−
* molecular weight:
+
* centisome position:
−
** 301.252    
+
** 88.173744    
 
* Synonym(s):
 
* Synonym(s):
−
** 4-nitrophenyl-α-D-galactopyranoside
 
−
** 4-nitrophenyl-α-D-galactoside
 
−
** p-nitrophenyl-α-D-galactoside
 
−
** pNPαGal
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17830]]
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=166092}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=82000 82000]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=167656}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=546840 546840]
+
{{#set: centisome position=88.173744   }}
−
{{#set: smiles=C(O)C2(C(O)C(O)C(O)C(OC1(C=CC(=CC=1)[N+]([O-])=O))O2)}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: inchi key=InChIKey=IFBHRQDFSNCLOZ-IIRVCBMXSA-N}}
+
−
{{#set: common name=p-nitrophenyl-α-D-galactopyranoside}}
+
−
{{#set: molecular weight=301.252   }}
+
−
{{#set: common name=4-nitrophenyl-α-D-galactopyranoside|4-nitrophenyl-α-D-galactoside|p-nitrophenyl-α-D-galactoside|pNPαGal}}
+
−
{{#set: consumed by=RXN-17830}}
+

Latest revision as of 16:11, 23 May 2018

Gene CHC_T00008683001

  • left end position:
    • 166092
  • transcription direction:
    • POSITIVE
  • right end position:
    • 167656
  • centisome position:
    • 88.173744
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008683001&oldid=13589"