Difference between revisions of "RXN-8340"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * smiles: ** C1(=NC(C([O-])=O)C...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8340 RXN-8340] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/4....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8340 RXN-8340] ==
−
* smiles:
+
* direction:
−
** C1(=NC(C([O-])=O)CC(O)1)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
+
** [http://enzyme.expasy.org/EC/4.1.99.22 EC-4.1.99.22]
−
* common name:
+
−
** (3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate
+
−
* molecular weight:
+
−
** 128.107   
+
 
* Synonym(s):
 
* Synonym(s):
−
** L-Δ1-pyrroline 3-hydroxy-5-carboxylate
 
−
** L-1pyrroline-3-hydroxy-5-carboxylate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-546]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[GTP]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Donor-H2]][c] '''=>''' 1 [[Acceptor]][c] '''+''' 1 [[MET]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CH33ADO]][c] '''+''' 1 [[CPD-19179]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 GTP[c] '''+''' 1 S-adenosyl-L-methionine[c] '''+''' 1 a reduced electron acceptor[c] '''=>''' 1 an oxidized electron acceptor[c] '''+''' 1 L-methionine[c] '''+''' 1 H+[c] '''+''' 1 5'-deoxyadenosine[c] '''+''' 1 (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00000814001_1]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
== Pathways  ==
 +
* [[PWY-6823]], molybdenum cofactor biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6823 PWY-6823]
 +
** '''7''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-ectocarpus_siliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26377 26377]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612]
+
** [http://www.genome.jp/dbget-bin/www_bget?R09394 R09394]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281]
+
{{#set: ec number=EC-4.1.99.22}}
−
* HMDB : HMDB01369
+
{{#set: gene associated=CHC_T00000814001_1}}
−
{{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}}
+
{{#set: in pathway=PWY-6823}}
−
{{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: common name=(3R,5S)-1-pyrroline-3-hydroxy-5-carboxylate}}
+
{{#set: reconstruction source=orthology-ectocarpus_siliculosus}}
−
{{#set: molecular weight=128.107    }}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1pyrroline-3-hydroxy-5-carboxylate}}
+
−
{{#set: consumed by=RXN66-546}}
+

Latest revision as of 15:12, 23 May 2018

Reaction RXN-8340

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GTP[c] + 1 S-adenosyl-L-methionine[c] + 1 a reduced electron acceptor[c] => 1 an oxidized electron acceptor[c] + 1 L-methionine[c] + 1 H+[c] + 1 5'-deoxyadenosine[c] + 1 (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6823, molybdenum cofactor biosynthesis: PWY-6823
    • 7 reactions found over 8 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-8340&oldid=13692"