Difference between revisions of "DUDP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-129 CPD1F-129] == * smiles: ** CC(C=CC=C(C=CC1(C(C)(C)CCCC=1C))C)=CC=CC=C(C=CC=C(C=CC2(=C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) * i...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DUDP DUDP] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2)) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K |
* common name: | * common name: | ||
| − | ** | + | ** dUDP |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 385.14 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2'-deoxyuridine-5'-diphosphate |
| + | ** deoxyuridine-diphosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14220]] |
| + | * [[DUDPKIN-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-722]] |
| + | * [[UDPREDUCT-RXN]] | ||
| + | * [[RXN-14219]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * BIGG : dudp |
| − | + | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246037 25246037] |
| − | * HMDB : | + | * HMDB : HMDB01000 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01346 C01346] |
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60471 60471] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC60471 |
| − | {{#set: smiles | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K}} |
| − | {{#set: common name= | + | {{#set: common name=dUDP}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=385.14 }} |
| − | {{#set: common name= | + | {{#set: common name=2'-deoxyuridine-5'-diphosphate|deoxyuridine-diphosphate}} |
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-14220|DUDPKIN-RXN}} |
| − | {{#set: produced by= | + | {{#set: produced by=RXN0-722|UDPREDUCT-RXN|RXN-14219}} |
| − | + | ||
Revision as of 15:13, 23 May 2018
Contents
Metabolite DUDP
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))
- inchi key:
- InChIKey=QHWZTVCCBMIIKE-SHYZEUOFSA-K
- common name:
- dUDP
- molecular weight:
- 385.14
- Synonym(s):
- 2'-deoxyuridine-5'-diphosphate
- deoxyuridine-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : dudp
- PUBCHEM:
- HMDB : HMDB01000
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC60471
"C(OP(=O)([O-])OP(=O)([O-])[O-])C1(OC(CC(O)1)N2(C=CC(=O)NC(=O)2))" cannot be used as a page name in this wiki.
