Difference between revisions of "CPD-15172"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] == * smiles: ** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3))) * in...")
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY4FS-7 PWY4FS-7] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15172 CPD-15172] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
 
* common name:
 
* common name:
** phosphatidylglycerol biosynthesis I (plastidic)
+
** 6,7-dehydrobaicalein
 +
* molecular weight:
 +
** 268.225   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''3''' reactions found over '''4''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[PGPPHOSPHA-RXN]]
+
* [[RXN-14240]]
* [[PHOSPHAGLYPSYN-RXN]]
+
== Reaction(s) of unknown directionality ==
* [[PWY0-1319]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-2759}}
+
* PUBCHEM:
{{#set: taxonomic range=TAX-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86200952 86200952]
{{#set: common name=phosphatidylglycerol biosynthesis I (plastidic)}}
+
{{#set: smiles=C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))}}
{{#set: reaction found=3}}
+
{{#set: inchi key=InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N}}
{{#set: reaction not found=4}}
+
{{#set: common name=6,7-dehydrobaicalein}}
{{#set: completion rate=75.0}}
+
{{#set: molecular weight=268.225    }}
 +
{{#set: produced by=RXN-14240}}

Revision as of 15:14, 23 May 2018

Metabolite CPD-15172

  • smiles:
    • C1(C=CC(=CC=1)C2(=CC(=O)C3(C(O2)=CC(=O)C(=O)C(O)=3)))
  • inchi key:
    • InChIKey=LSQWCIYRGVWPFX-UHFFFAOYSA-N
  • common name:
    • 6,7-dehydrobaicalein
  • molecular weight:
    • 268.225
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links