Difference between revisions of "RXN-13304"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] == * smiles: ** C(NC1(NC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13304 RXN-13304] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE AMINO-RIBOSYLAMINO-1H-3H-PYR-DIONE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13304 RXN-13304] ==
−
* smiles:
+
* direction:
−
** C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N
+
** [http://enzyme.expasy.org/EC/4.2.1.134 EC-4.2.1.134]
−
* common name:
+
−
** 5-amino-6-(D-ribitylamino)uracil
+
−
* molecular weight:
+
−
** 276.249   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine
 
−
** 5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione
 
−
** ARP
 
−
** 6-(1-D-ribitylamino)-5-aminouracil
 
−
** 5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[LUMAZINESYN-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-14277]][c] '''=>''' 1 [[CPD-14282]][c] '''+''' 1 [[WATER]][c]
−
* [[RIBOFLAVIN-SYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] '''=>''' 1 trans-lignocer-2-enoyl-CoA[c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
 +
** '''8''' reactions found over '''16''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[gap-filling]]
 +
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
*** Tool: [[meneco]]
 +
**** Comment: [[added for gapfilling]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04732 C04732]
+
{{#set: ec number=EC-4.2.1.134}}
−
* CHEBI:
+
{{#set: in pathway=PWY-7036}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15934 15934]
+
{{#set: reconstruction category=gap-filling}}
−
* BIGG : 4r5au
+
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
−
* PUBCHEM:
+
{{#set: reconstruction tool=meneco}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=193516 193516]
+
{{#set: reconstruction comment=added for gapfilling}}
−
* HMDB : HMDB11106
+
−
{{#set: smiles=C(NC1(NC(NC(=O)C(N)=1)=O))C(O)C(O)C(O)CO}}
+
−
{{#set: inchi key=InChIKey=XKQZIXVJVUPORE-RPDRRWSUSA-N}}
+
−
{{#set: common name=5-amino-6-(D-ribitylamino)uracil}}
+
−
{{#set: molecular weight=276.249    }}
+
−
{{#set: common name=6-(1-D-ribitylamino)-5-amino-2,4-dihydroxypyrimidine|5-amino-6-ribitylamino-2,4(1H,3H)-pyrimidinedione|ARP|6-(1-D-ribitylamino)-5-aminouracil|5-amino-6-(1-D-ribitylamino)pyrimidine-2,4(1H,3H)-dione}}
+
−
{{#set: consumed by=LUMAZINESYN-RXN}}
+
−
{{#set: produced by=RIBOFLAVIN-SYN-RXN}}
+

Latest revision as of 16:16, 23 May 2018

Reaction RXN-13304

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (3R)-3-hydroxy-lignoceroyl-CoA[c] => 1 trans-lignocer-2-enoyl-CoA[c] + 1 H2O[c]

Genes associated with this reaction

Pathways

  • PWY-7036, very long chain fatty acid biosynthesis II: PWY-7036
    • 8 reactions found over 16 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-13304&oldid=13871"