Difference between revisions of "CHC T00008638001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O...")
 
(Created page with "Category:Gene == Gene CHC_T00008638001 == * left end position: ** 295764 * transcription direction: ** POSITIVE * right end position: ** 296690 * centisome position: ** 66...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-201 CPD-201] ==
+
== Gene CHC_T00008638001 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 295764
−
* inchi key:
+
* transcription direction:
−
** InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 4-hydroxybenzoyl-CoA
+
** 296690
−
* molecular weight:
+
* centisome position:
−
** 883.61    
+
** 66.59461    
 
* Synonym(s):
 
* Synonym(s):
−
** p-hydroxybenzoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-11246]]
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=295764}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266585 45266585]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=296690}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57356 57356]
+
{{#set: centisome position=66.59461   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02949 C02949]
+
−
* HMDB : HMDB06467
+
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(C1(=CC=C(O)C=C1))=O)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=LTVXPVBFJBTNIJ-TYHXJLICSA-J}}
+
−
{{#set: common name=4-hydroxybenzoyl-CoA}}
+
−
{{#set: molecular weight=883.61   }}
+
−
{{#set: common name=p-hydroxybenzoyl-CoA}}
+
−
{{#set: produced by=RXN-11246}}
+

Latest revision as of 15:19, 23 May 2018

Gene CHC_T00008638001

  • left end position:
    • 295764
  • transcription direction:
    • POSITIVE
  • right end position:
    • 296690
  • centisome position:
    • 66.59461
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00008638001&oldid=13980"