Difference between revisions of "RS-Malate"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] == * smiles: ** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-Malate RS-Malate] == * common name: ** (RS)-malate * Synonym(s): ** (RS)-malic acid ** DL-ap...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LANOSTEROL LANOSTEROL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RS-Malate RS-Malate] ==
−
* smiles:
+
−
** CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C
+
−
* inchi key:
+
−
** InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N
+
 
* common name:
 
* common name:
−
** lanosterol
+
** (RS)-malate
−
* molecular weight:
+
−
** 426.724   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol
+
** (RS)-malic acid
 +
** DL-apple acid
 +
** DL-malic acid
 +
** hydroxysuccinic acid
 +
** hydroxybutanedioic acid
 +
** malic acid
 +
** DL-malate
 +
** malate
 +
** 2-hydroxybutanedioate
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN3O-130]]
+
* [[TRANS-RXN1HP7-18]]
−
* [[RXN66-303]]
+
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[TRANS-RXN1HP7-18]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 79-63-0
+
{{#set: common name=(RS)-malate}}
−
* DRUGBANK : DB03696
+
{{#set: common name=(RS)-malic acid|DL-apple acid|DL-malic acid|hydroxysuccinic acid|hydroxybutanedioic acid|malic acid|DL-malate|malate|2-hydroxybutanedioate}}
−
* PUBCHEM:
+
{{#set: consumed by=TRANS-RXN1HP7-18}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=246983 246983]
+
{{#set: produced by=TRANS-RXN1HP7-18}}
−
* HMDB : HMDB01251
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C01724 C01724]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16521 16521]
+
−
* METABOLIGHTS : MTBLC16521
+
−
{{#set: smiles=CC(C)=CCCC([CH]1(C2(C)(C(C)(CC1)C4(=C(CC2)C3([CH](C(C)(C)C(O)CC3)CC4)(C)))))C}}
+
−
{{#set: inchi key=InChIKey=CAHGCLMLTWQZNJ-BQNIITSRSA-N}}
+
−
{{#set: common name=lanosterol}}
+
−
{{#set: molecular weight=426.724    }}
+
−
{{#set: common name=4,4,14α-trimethyl-5α-cholesta-8,24-dien-3β-ol}}
+
−
{{#set: consumed by=RXN3O-130|RXN66-303}}
+

Latest revision as of 15:22, 23 May 2018

Metabolite RS-Malate

  • common name:
    • (RS)-malate
  • Synonym(s):
    • (RS)-malic acid
    • DL-apple acid
    • DL-malic acid
    • hydroxysuccinic acid
    • hydroxybutanedioic acid
    • malic acid
    • DL-malate
    • malate
    • 2-hydroxybutanedioate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RS-Malate&oldid=14110"