Difference between revisions of "TransportSeed CU+2"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] == * smiles: ** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1163 CPD0-1163] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed_CU+2 TransportSeed_CU+2] ==
−
* smiles:
+
* direction:
−
** CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J
+
−
* common name:
+
−
** (S)-3-hydroxy-(5Z)-tetradecenoyl-CoA
+
−
* molecular weight:
+
−
** 987.845   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (S)-3-hydroxy-5-cis-tetradecenoyl-CoA
 
−
** (S)-3-hydroxy-14:1-Δ5-CoA
 
−
** (3S)-hydroxy-5-cis-tetradecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN0-5393]]
+
** 1.0 [[CU+2]][e] '''=>''' 1.0 [[CU+2]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 Cu2+[e] '''=>''' 1.0 Cu2+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-import_from_medium]]
 +
*** Comment: [[added to manage seeds from extracellular to cytosol compartment]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244729 25244729]
+
{{#set: in pathway=}}
−
{{#set: smiles=CCCCCCCCC=CCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: reconstruction category=manual}}
−
{{#set: inchi key=InChIKey=KJJPUIFALMAQPF-SUAKZGBESA-J}}
+
{{#set: reconstruction source=manual-import_from_medium}}
−
{{#set: common name=(S)-3-hydroxy-(5Z)-tetradecenoyl-CoA}}
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
−
{{#set: molecular weight=987.845    }}
+
−
{{#set: common name=(S)-3-hydroxy-5-cis-tetradecenoyl-CoA|(S)-3-hydroxy-14:1-Δ5-CoA|(3S)-hydroxy-5-cis-tetradecenoyl-CoA}}
+
−
{{#set: produced by=RXN0-5393}}
+

Latest revision as of 15:22, 23 May 2018

Reaction TransportSeed_CU+2

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 Cu2+[e] => 1.0 Cu2+[c]

Genes associated with this reaction

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=TransportSeed_CU%2B2&oldid=14139"