Difference between revisions of "CHC T00009270001"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
 
(Created page with "Category:Gene == Gene CHC_T00009270001 == * left end position: ** 189450 * transcription direction: ** POSITIVE * right end position: ** 190634 * centisome position: ** 79...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Gene CHC_T00009270001 ==
−
* smiles:
+
* left end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
** 189450
−
* common name:
+
* transcription direction:
−
** chlorophyllide a
+
** POSITIVE
−
* molecular weight:
+
* right end position:
−
** 612.967    
+
** 190634
 +
* centisome position:
 +
** 79.108574    
 
* Synonym(s):
 
* Synonym(s):
−
** chlorophyllide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7663]]
+
* Reaction: [[HISTONE-ACETYLTRANSFERASE-RXN]]
−
* [[RXN-17429]]
+
** Source: [[annotation-original_genome]]
−
== Reaction(s) known to produce the compound ==
+
*** Assignment: automated-name-match
−
* [[RXN-5286]]
+
== Pathways associated ==
−
== Reaction(s) of unknown directionality ==
+
−
* [[RXN1F-10]]
+
−
* [[RXN1F-66]]
+
 
== External links  ==
 
== External links  ==
−
* CAS : 14897-06-4
+
{{#set: left end position=189450}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
{{#set: right end position=190634}}
−
* CHEBI:
+
{{#set: centisome position=79.108574    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
{{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyllide a}}
+
−
{{#set: molecular weight=612.967    }}
+
−
{{#set: common name=chlorophyllide}}
+
−
{{#set: consumed by=RXN-7663|RXN-17429}}
+
−
{{#set: produced by=RXN-5286}}
+
−
{{#set: consumed or produced by=RXN1F-10|RXN1F-66}}
+

Latest revision as of 15:23, 23 May 2018

Gene CHC_T00009270001

  • left end position:
    • 189450
  • transcription direction:
    • POSITIVE
  • right end position:
    • 190634
  • centisome position:
    • 79.108574
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=CHC_T00009270001&oldid=14191"