Difference between revisions of "CHC T00009504001"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14926 CPD-14926] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=C[CH]=O * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene CHC_T00009504001 == * left end position: ** 22554 * transcription direction: ** POSITIVE * right end position: ** 23926 * centisome position: ** 63.2...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009504001 == |
− | * | + | * left end position: |
− | ** | + | ** 22554 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 23926 |
− | * | + | * centisome position: |
− | ** | + | ** 63.24911 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[2.7.11.24-RXN]] |
− | + | ** Source: [[annotation-original_genome]] | |
− | * [[ | + | *** Assignment: automated-name-match |
− | == | + | == Pathways associated == |
== External links == | == External links == | ||
− | + | {{#set: left end position=22554}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=23926}} | |
− | {{#set: | + | {{#set: centisome position=63.24911 }} |
− | {{#set: | + | {{#set: reaction associated=2.7.11.24-RXN}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 15:27, 23 May 2018
Gene CHC_T00009504001
- left end position:
- 22554
- transcription direction:
- POSITIVE
- right end position:
- 23926
- centisome position:
- 63.24911
- Synonym(s):
Reactions associated
- Reaction: 2.7.11.24-RXN
- Source: annotation-original_genome
- Assignment: automated-name-match
- Source: annotation-original_genome