Difference between revisions of "PWY-7666"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DEOXYINOSINE DEOXYINOSINE] == * smiles: ** C(O)C1(OC(CC(O)1)N3(C=NC2(=C(O)N=CN=C23))) * inchi k...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7666 PWY-7666] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** galactolipid biosynthesis II |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** galactosylglyceride biosynthesis II |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''3''' reactions in the full pathway | |
| − | * [[ | + | * [[RXN-1225]] |
| − | == Reaction(s) | + | ** 1 associated gene(s): |
| + | *** [[CHC_T00008344001_1]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-ectocarpus_siliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16647 RXN-16647] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-16648 RXN-16648] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-1117}} | |
| − | + | {{#set: common name=galactolipid biosynthesis II}} | |
| − | + | {{#set: common name=galactosylglyceride biosynthesis II}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:27, 23 May 2018
Pathway PWY-7666
- taxonomic range:
- common name:
- galactolipid biosynthesis II
- Synonym(s):
- galactosylglyceride biosynthesis II
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-1225
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
