Difference between revisions of "RXN-16654"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16654 RXN-16654] == * direction: ** REVERSIBLE * common name: ** aldehyde dehydrogenase, (NAD)...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8617 CPD-8617] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16654 RXN-16654] ==
−
* smiles:
+
* direction:
−
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N
+
 
* common name:
 
* common name:
−
** 4α-hydroxymethyl-5α-cholesta-8-en-3β-ol
+
** aldehyde dehydrogenase, (NAD) activity
−
* molecular weight:
+
* ec number:
−
** 416.686   
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN66-21]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-7880]][c] '''<=>''' 1 [[DODECANOATE]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[NADH]][c]
−
* [[RXN66-20]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 dodecanal[c] '''<=>''' 1 laurate[c] '''+''' 2 H+[c] '''+''' 1 NADH[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00008341001]]
 +
** Source: [[annotation-original_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[CHC_T00008341001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-original_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263322 44263322]
+
{{#set: common name=aldehyde dehydrogenase, (NAD) activity}}
−
* CHEBI:
+
{{#set: ec number=EC-1.2.1.3}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87053 87053]
+
{{#set: gene associated=CHC_T00008341001|CHC_T00008341001_1}}
−
* HMDB : HMDB12173
+
{{#set: in pathway=}}
−
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(CO)C(O)CC3)))CC4)))C}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: inchi key=InChIKey=UPEGTKGKNWDIAN-NUESBDPTSA-N}}
+
{{#set: reconstruction source=annotation-original_genome|orthology-galdieria.sulphuraria}}
−
{{#set: common name=4&alpha;-hydroxymethyl-5&alpha;-cholesta-8-en-3&beta;-ol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=416.686    }}
+
−
{{#set: consumed by=RXN66-21}}
+
−
{{#set: produced by=RXN66-20}}
+

Revision as of 15:29, 23 May 2018

Reaction RXN-16654

  • direction:
    • REVERSIBLE
  • common name:
    • aldehyde dehydrogenase, (NAD) activity
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 H2O[c] + 1 dodecanal[c] <=> 1 laurate[c] + 2 H+[c] + 1 NADH[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=RXN-16654&oldid=14477"