Difference between revisions of "CPD-9904"
From metabolic_network
(Created page with "Category:Gene == Gene CHC_T00008523001_1 == * Synonym(s): == Reactions associated == * 6PGLUCONDEHYDROG-RXN ** pantograph-a.taliana ** pantograph-a.tali...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9904 CPD-9904] == |
+ | * smiles: | ||
+ | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M | ||
+ | * common name: | ||
+ | ** 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate | ||
+ | * molecular weight: | ||
+ | ** 643.968 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-methoxy-4-hydroxy-5-heptaprenylbenzoate | ||
+ | ** 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid | ||
+ | ** 3-heptaprenyl-4-hydroxy-5-methoxybenzoate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9287]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54746223 54746223] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84454 84454] | ||
+ | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M}} | ||
+ | {{#set: common name=3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate}} | ||
+ | {{#set: molecular weight=643.968 }} | ||
+ | {{#set: common name=3-methoxy-4-hydroxy-5-heptaprenylbenzoate|3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-heptaprenyl-4-hydroxy-5-methoxybenzoate}} | ||
+ | {{#set: produced by=RXN-9287}} |
Revision as of 16:30, 23 May 2018
Contents
Metabolite CPD-9904
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C
- inchi key:
- InChIKey=KYBJQEICWVEWIL-TUUMQRACSA-M
- common name:
- 3-methoxy-4-hydroxy-5-all-trans-heptaprenylbenzoate
- molecular weight:
- 643.968
- Synonym(s):
- 3-methoxy-4-hydroxy-5-heptaprenylbenzoate
- 3-(3,7,11,15,19,23-heptamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
- 3-heptaprenyl-4-hydroxy-5-methoxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C" cannot be used as a page name in this wiki.