Difference between revisions of "CHC T00001019001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9000 CPD-9000] == * smiles: ** C(CCC(C([O-])=O)[N+])(NCCCC(=O)[O-])=O * inchi key: ** InChI...") |
(Created page with "Category:Gene == Gene CHC_T00001019001_1 == * Synonym(s): == Reactions associated == * Reaction: ATPASE-RXN ** Source: orthology-ectocarpus_siliculosus == Pathway...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene CHC_T00001019001_1 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[ | + | * Reaction: [[ATPASE-RXN]] |
| − | + | ** Source: [[orthology-ectocarpus_siliculosus]] | |
| − | == | + | == Pathways associated == |
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=ATPASE-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
Latest revision as of 16:30, 23 May 2018
Gene CHC_T00001019001_1
- Synonym(s):
Reactions associated
- Reaction: ATPASE-RXN
- Source: orthology-ectocarpus_siliculosus
