Difference between revisions of "PWY-7036"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] == * smiles: ** C1(=CC(NC(=O)N1)=O) * inchi key: ** InChIKey=ISAKRJDGNUQOIC-UHFF...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URACIL URACIL] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036] ==
−
* smiles:
+
* taxonomic range:
−
** C1(=CC(NC(=O)N1)=O)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
** InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** uracil
+
** very long chain fatty acid biosynthesis II
−
* molecular weight:
+
−
** 112.088   
+
 
* Synonym(s):
 
* Synonym(s):
−
** U
+
** cerotate biosynthesis
 +
** hexacosanoate biosynthesis
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[URACIL-PRIBOSYLTRANS-RXN]]
+
'''8''' reactions found over '''16''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-13295]]
−
* [[RXN0-2584]]
+
** 0 associated gene:
−
== Reaction(s) of unknown directionality ==
+
** 1 reconstruction source(s) associated:
−
* [[RXN0-5398]]
+
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13297]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13299]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13300]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13303]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13304]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13307]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
* [[RXN-13308]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13294 RXN-13294]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13296 RXN-13296]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13298 RXN-13298]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13301 RXN-13301]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13302 RXN-13302]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13305 RXN-13305]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13306 RXN-13306]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-13309 RXN-13309]
 
== External links  ==
 
== External links  ==
−
* CAS : 66-22-8
+
{{#set: taxonomic range=TAX-2759}}
−
* METABOLIGHTS : MTBLC17568
+
{{#set: taxonomic range=TAX-2}}
−
* DRUGBANK : DB03419
+
{{#set: common name=very long chain fatty acid biosynthesis II}}
−
* PUBCHEM:
+
{{#set: common name=cerotate biosynthesis|hexacosanoate biosynthesis}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1174 1174]
+
{{#set: reaction found=8}}
−
* HMDB : HMDB00300
+
{{#set: total reaction=16}}
−
* LIGAND-CPD:
+
{{#set: completion rate=50.0}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00106 C00106]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.1141.html 1141]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17568 17568]
+
−
* BIGG : ura
+
−
{{#set: smiles=C1(=CC(NC(=O)N1)=O)}}
+
−
{{#set: inchi key=InChIKey=ISAKRJDGNUQOIC-UHFFFAOYSA-N}}
+
−
{{#set: common name=uracil}}
+
−
{{#set: molecular weight=112.088    }}
+
−
{{#set: common name=U}}
+
−
{{#set: consumed by=URACIL-PRIBOSYLTRANS-RXN}}
+
−
{{#set: produced by=RXN0-2584}}
+
−
{{#set: consumed or produced by=RXN0-5398}}
+

Revision as of 16:31, 23 May 2018

Pathway PWY-7036

  • taxonomic range:
  • common name:
    • very long chain fatty acid biosynthesis II
  • Synonym(s):
    • cerotate biosynthesis
    • hexacosanoate biosynthesis

Reaction(s) found

8 reactions found over 16 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ccrgem/index.php?title=PWY-7036&oldid=14543"