Difference between revisions of "GAPDHSYNEC-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] == * smiles: ** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy....")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1414 CPD0-1414] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPDHSYNEC-RXN GAPDHSYNEC-RXN] ==
* smiles:
+
* direction:
** CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N
+
** [http://enzyme.expasy.org/EC/1.2.1.59 EC-1.2.1.59]
* common name:
+
** tetracycline
+
* molecular weight:
+
** 444.44   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[TRANS-RXN1HP7-17]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[GAP]][c] '''+''' 1 [[Pi]][c] '''<=>''' 1 [[DPG]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c]
* [[TRANS-RXN1HP7-17]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 NAD(P)+[c] '''+''' 1 D-glyceraldehyde 3-phosphate[c] '''+''' 1 phosphate[c] '''<=>''' 1 1,3-bisphospho-D-glycerate[c] '''+''' 1 NAD(P)H[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[CHC_T00009438001_1]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-galdieria.sulphuraria]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=27885548 27885548]
+
{{#set: ec number=EC-1.2.1.59}}
* CHEBI:
+
{{#set: gene associated=CHC_T00009438001_1}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71392 71392]
+
{{#set: in pathway=}}
{{#set: smiles=CC1(O)(C4(C(C(=O)C2(=C(O)C3(O)(C(=O)C(C(=O)N)=C([O-])C([N+](C)C)[CH](C[CH]12)3)))=C(O)C=CC=4))}}
+
{{#set: reconstruction category=orthology}}
{{#set: inchi key=InChIKey=OFVLGDICTFRJMM-WESIUVDSSA-N}}
+
{{#set: reconstruction source=orthology-galdieria.sulphuraria}}
{{#set: common name=tetracycline}}
+
{{#set: reconstruction tool=pantograph}}
{{#set: molecular weight=444.44    }}
+
{{#set: consumed by=TRANS-RXN1HP7-17}}
+
{{#set: produced by=TRANS-RXN1HP7-17}}
+

Latest revision as of 16:31, 23 May 2018

Reaction GAPDHSYNEC-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD(P)+[c] + 1 D-glyceraldehyde 3-phosphate[c] + 1 phosphate[c] <=> 1 1,3-bisphospho-D-glycerate[c] + 1 NAD(P)H[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links