Difference between revisions of "CHC T00009177001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINOLINATE QUINOLINATE] == * smiles: ** C1(=CC=C(C(C([O-])=O)=N1)C([O-])=O) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene CHC_T00009177001_1 == * Synonym(s): == Reactions associated == * Reaction: LYSOPHOSPHOLIPASE-RXN ** Source: orthology-galdieria.sulphuraria...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00009177001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[LYSOPHOSPHOLIPASE-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | * Reaction: [[RXN-15035]] |
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7409]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=LYSOPHOSPHOLIPASE-RXN|RXN-15035}} | |
− | + | {{#set: pathway associated=PWY-7409}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Latest revision as of 15:34, 23 May 2018
Gene CHC_T00009177001_1
- Synonym(s):
Reactions associated
- Reaction: LYSOPHOSPHOLIPASE-RXN
- Source: orthology-galdieria.sulphuraria
- Reaction: RXN-15035
- Source: orthology-galdieria.sulphuraria