Difference between revisions of "CHC T00004094001 1"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLEYL-CPD INDOLEYL-CPD] == * smiles: ** C2(NC1(C=CC=CC=1C(CC#N)=2)) * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene CHC_T00004094001_1 == * Synonym(s): == Reactions associated == * Reaction: 7KAPSYN-RXN ** Source: orthology-galdieria.sulphuraria ** Source:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene CHC_T00004094001_1 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[7KAPSYN-RXN]] |
− | + | ** Source: [[orthology-galdieria.sulphuraria]] | |
− | == | + | ** Source: [[orthology-ectocarpus_siliculosus]] |
+ | ** Source: [[orthology-arabidopsis_thaliana]] | ||
+ | * Reaction: [[RXN-11484]] | ||
+ | ** Source: [[orthology-galdieria.sulphuraria]] | ||
+ | ** Source: [[orthology-ectocarpus_siliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-6578]] | ||
+ | * [[PWY-6519]] | ||
+ | * [[PWY-7147]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=7KAPSYN-RXN|RXN-11484}} | |
− | + | {{#set: pathway associated=PWY-6578|PWY-6519|PWY-7147}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 15:34, 23 May 2018
Gene CHC_T00004094001_1
- Synonym(s):
Reactions associated
- Reaction: 7KAPSYN-RXN
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus
- Source: orthology-arabidopsis_thaliana
- Reaction: RXN-11484
- Source: orthology-galdieria.sulphuraria
- Source: orthology-ectocarpus_siliculosus